About 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole
1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole (PubChem CID 66738373) has the molecular formula C18H16BClO2
and a molecular weight of 310.59 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole.
Molecular Properties
| Compound Name | 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole |
| PubChem CID | 66738373 |
| Molecular Formula | C18H16BClO2 |
| Molecular Weight | 310.59 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole |
| SMILES | COc1cc(Cl)ccc1C1CCC=C2OB=C3C=CC=CC321 |
| InChI | InChI=1S/C18H16BClO2/c1-21-15-11-12(20)8-9-13(15)14-5-4-7-17-18(14)10-3-2-6-16(18)19-22-17/h2-3,6-11,14H,4-5H2,1H3 |
| InChIKey | YQAAYZFWEHIEBZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole?
The IUPAC name of 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole (CID 66738373) is 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole.
What is the SMILES notation for 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole?
The canonical SMILES for 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole is COc1cc(Cl)ccc1C1CCC=C2OB=C3C=CC=CC321.
What is the InChIKey of 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole?
The InChIKey is YQAAYZFWEHIEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BClO2/c1-21-15-11-12(20)8-9-13(15)14-5-4-7-17-18(14)10-3-2-6-16(18)19-22-17/h2-3,6-11,14H,4-5H2,1H3.
What are the key properties of 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole?
1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole has a molecular weight of 310.59 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-methoxyphenyl)-2,3-dihydro-1H-benzo[c][1,2]benzoxaborole is sourced from PubChem (CID 66738373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).