C35H52BrFN6O3Si2 — CID 66738579
6-bromo-5-[[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]methyl]-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66738579) has the molecular formula C35H52BrFN6O3Si2 and a molecular weight of 759.91 g/mol. Its IUPAC name is 6-bromo-5-[[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]methyl]-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-bromo-5-[[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]methyl]-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66738579 |
| Molecular Formula | C35H52BrFN6O3Si2 |
| Molecular Weight | 759.91 g/mol |
| Exact Mass | 758.28 |
| IUPAC Name | 6-bromo-5-[[[(2S,6R)-2,6-dimethyloxan-4-yl]amino]methyl]-3-(6-fluoroquinolin-3-yl)-N,N-bis(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@@H]1CC(NCc2nc3c(-c4cnc5ccc(F)cc5c4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)C[C@H](C)O1 |
| InChI | InChI=1S/C35H52BrFN6O3Si2/c1-24-15-29(16-25(2)46-24)38-21-32-33(36)35(42(22-44-11-13-47(3,4)5)23-45-12-14-48(6,7)8)43-34(41-32)30(20-40-43)27-17-26-18-28(37)9-10-31(26)39-19-27/h9-10,17-20,24-25,29,38H,11-16,21-23H2,1-8H3/t24-,25+,29? |
| InChIKey | OPFAANHSVBHJCA-CIYIZKPCSA-N |
| XLogP | 8.32 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.91 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|