About 5,8a-dihydrochromen-8-one
5,8a-dihydrochromen-8-one (PubChem CID 66738702) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is 5,8a-dihydrochromen-8-one.
Molecular Properties
| Compound Name | 5,8a-dihydrochromen-8-one |
| PubChem CID | 66738702 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 5,8a-dihydrochromen-8-one |
| SMILES | O=C1C=CCC2=CC=COC12 |
| InChI | InChI=1S/C9H8O2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-2,4-6,9H,3H2 |
| InChIKey | NVVFKRAAFBRBHD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,8a-dihydrochromen-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8a-dihydrochromen-8-one?
The IUPAC name of 5,8a-dihydrochromen-8-one (CID 66738702) is 5,8a-dihydrochromen-8-one.
What is the SMILES notation for 5,8a-dihydrochromen-8-one?
The canonical SMILES for 5,8a-dihydrochromen-8-one is O=C1C=CCC2=CC=COC12.
What is the InChIKey of 5,8a-dihydrochromen-8-one?
The InChIKey is NVVFKRAAFBRBHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-2,4-6,9H,3H2.
What are the key properties of 5,8a-dihydrochromen-8-one?
5,8a-dihydrochromen-8-one has a molecular weight of 148.16 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8a-dihydrochromen-8-one is sourced from PubChem (CID 66738702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).