C23H38O4 — CID 66738708
(6Z,9Z,12Z)-5-(1,3-dioxan-2-ylmethyl)octadeca-6,9,12-trienoic acid (PubChem CID 66738708) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (6Z,9Z,12Z)-5-(1,3-dioxan-2-ylmethyl)octadeca-6,9,12-trienoic acid.
| Compound Name | (6Z,9Z,12Z)-5-(1,3-dioxan-2-ylmethyl)octadeca-6,9,12-trienoic acid |
|---|---|
| PubChem CID | 66738708 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (6Z,9Z,12Z)-5-(1,3-dioxan-2-ylmethyl)octadeca-6,9,12-trienoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C(CCCC(=O)O)CC1OCCCO1 |
| InChI | InChI=1S/C23H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-15-21(16-13-17-22(24)25)20-23-26-18-14-19-27-23/h6-7,9-10,12,15,21,23H,2-5,8,11,13-14,16-20H2,1H3,(H,24,25)/b7-6-,10-9-,15-12- |
| InChIKey | WINLJPBCYYUMPP-WONBGBOQSA-N |
| XLogP | 6.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|