C33H46N6O4Si2 — CID 66738725
4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 66738725) has the molecular formula C33H46N6O4Si2 and a molecular weight of 646.94 g/mol. Its IUPAC name is 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 66738725 |
| Molecular Formula | C33H46N6O4Si2 |
| Molecular Weight | 646.94 g/mol |
| Exact Mass | 646.31 |
| IUPAC Name | 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2=CCN(C(=O)O)CC2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C33H46N6O4Si2/c1-44(2,3)17-15-42-23-38(24-43-16-18-45(4,5)6)31-20-30(25-11-13-37(14-12-25)33(40)41)36-32-28(22-35-39(31)32)27-19-26-9-7-8-10-29(26)34-21-27/h7-11,19-22H,12-18,23-24H2,1-6H3,(H,40,41) |
| InChIKey | VHJKUAHFEGRLNG-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.94 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|