C41H56BrN5O6Si2 — CID 66738870
ethyl 2-acetyloxy-2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]acetate (PubChem CID 66738870) has the molecular formula C41H56BrN5O6Si2 and a molecular weight of 851.00 g/mol. Its IUPAC name is ethyl 2-acetyloxy-2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]acetate.
| Compound Name | ethyl 2-acetyloxy-2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]acetate |
|---|---|
| PubChem CID | 66738870 |
| Molecular Formula | C41H56BrN5O6Si2 |
| Molecular Weight | 851.00 g/mol |
| Exact Mass | 849.30 |
| IUPAC Name | ethyl 2-acetyloxy-2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]acetate |
| SMILES | CCOC(=O)C(OC(C)=O)=C1CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C41H56BrN5O6Si2/c1-9-52-41(49)38(53-29(2)48)32-17-15-31(16-18-32)37-36(42)40(46(27-50-21-23-54(3,4)5)28-51-22-24-55(6,7)8)47-39(45-37)34(26-44-47)33-19-20-35(43-25-33)30-13-11-10-12-14-30/h10-14,19-20,25-26,31H,9,15-18,21-24,27-28H2,1-8H3/b38-32- |
| InChIKey | ZJRNPCPYQYQGPG-IFZQRFIDSA-N |
| XLogP | 9.69 |
| TPSA | 117.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.00 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|