C41H56BrN5O6Si2 — CID 66739038
2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]-2-butanoyloxyacetic acid (PubChem CID 66739038) has the molecular formula C41H56BrN5O6Si2 and a molecular weight of 851.00 g/mol. Its IUPAC name is 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]-2-butanoyloxyacetic acid.
| Compound Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]-2-butanoyloxyacetic acid |
|---|---|
| PubChem CID | 66739038 |
| Molecular Formula | C41H56BrN5O6Si2 |
| Molecular Weight | 851.00 g/mol |
| Exact Mass | 849.30 |
| IUPAC Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexylidene]-2-butanoyloxyacetic acid |
| SMILES | CCCC(=O)OC(C(=O)O)=C1CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2Br)CC1 |
| InChI | InChI=1S/C41H56BrN5O6Si2/c1-8-12-35(48)53-38(41(49)50)31-17-15-30(16-18-31)37-36(42)40(46(27-51-21-23-54(2,3)4)28-52-22-24-55(5,6)7)47-39(45-37)33(26-44-47)32-19-20-34(43-25-32)29-13-10-9-11-14-29/h9-11,13-14,19-20,25-26,30H,8,12,15-18,21-24,27-28H2,1-7H3,(H,49,50)/b38-31- |
| InChIKey | ZQIDWYGIDWLPPV-NXKIGICWSA-N |
| XLogP | 9.99 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.00 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|