C33H45BrN8O4Si2 — CID 66739269
7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 66739269) has the molecular formula C33H45BrN8O4Si2 and a molecular weight of 753.85 g/mol. Its IUPAC name is 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 66739269 |
| Molecular Formula | C33H45BrN8O4Si2 |
| Molecular Weight | 753.85 g/mol |
| Exact Mass | 752.23 |
| IUPAC Name | 7-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-bromo-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1c(Br)c(N2CCN3C(=O)NC(=O)C3C2)nc2c(-c3cnc4ccccc4c3)cnn12 |
| InChI | InChI=1S/C33H45BrN8O4Si2/c1-47(2,3)15-13-45-21-40(22-46-14-16-48(4,5)6)32-28(34)30(39-11-12-41-27(20-39)31(43)38-33(41)44)37-29-25(19-36-42(29)32)24-17-23-9-7-8-10-26(23)35-18-24/h7-10,17-19,27H,11-16,20-22H2,1-6H3,(H,38,43,44) |
| InChIKey | CCXOZYNOIRNZJC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.85 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|