C25H38N8O3 — CID 66739309
N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 66739309) has the molecular formula C25H38N8O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 66739309 |
| Molecular Formula | C25H38N8O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)N2Cc3c(NC(=O)c4ccn(C)n4)n[nH]c3C2(C)C)[C@@H](C)CN1CC1CCOCC1 |
| InChI | InChI=1S/C25H38N8O3/c1-16-13-32(17(2)12-31(16)14-18-7-10-36-11-8-18)24(35)33-15-19-21(25(33,3)4)27-28-22(19)26-23(34)20-6-9-30(5)29-20/h6,9,16-18H,7-8,10-15H2,1-5H3,(H2,26,27,28,34)/t16-,17+/m1/s1 |
| InChIKey | LPPBURXFKAEPQJ-SJORKVTESA-N |
| XLogP | 2.39 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |