C41H53N5O6Si2 — CID 66739610
methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate (PubChem CID 66739610) has the molecular formula C41H53N5O6Si2 and a molecular weight of 768.08 g/mol. Its IUPAC name is methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate.
| Compound Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate |
|---|---|
| PubChem CID | 66739610 |
| Molecular Formula | C41H53N5O6Si2 |
| Molecular Weight | 768.08 g/mol |
| Exact Mass | 767.35 |
| IUPAC Name | methyl 4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-(1-ethoxyethenyl)-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]oxybenzoate |
| SMILES | C=C(OCC)c1c(Oc2ccc(C(=O)OC)cc2)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C41H53N5O6Si2/c1-10-51-30(2)37-39(52-34-19-16-32(17-20-34)41(47)48-3)44-38-35(33-18-21-36(42-26-33)31-14-12-11-13-15-31)27-43-46(38)40(37)45(28-49-22-24-53(4,5)6)29-50-23-25-54(7,8)9/h11-21,26-27H,2,10,22-25,28-29H2,1,3-9H3 |
| InChIKey | OBQLEUVWOLDRRI-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 109.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.08 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|