About 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one
3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one (PubChem CID 66739843) has the molecular formula C9H7FN2O2
and a molecular weight of 194.16 g/mol. Its IUPAC name is 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one |
| PubChem CID | 66739843 |
| Molecular Formula | C9H7FN2O2 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one |
| SMILES | COc1ccc2cc(F)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C9H7FN2O2/c1-14-7-3-2-5-4-6(10)9(13)12-8(5)11-7/h2-4H,1H3,(H,11,12,13) |
| InChIKey | MZYMEOICAZMVEX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one?
The IUPAC name of 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one (CID 66739843) is 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one is COc1ccc2cc(F)c(=O)[nH]c2n1.
What is the InChIKey of 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one?
The InChIKey is MZYMEOICAZMVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN2O2/c1-14-7-3-2-5-4-6(10)9(13)12-8(5)11-7/h2-4H,1H3,(H,11,12,13).
What are the key properties of 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one?
3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one has a molecular weight of 194.16 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-7-methoxy-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 66739843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).