About 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole
2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole (PubChem CID 66739967) has the molecular formula C9H5IN4S
and a molecular weight of 328.14 g/mol. Its IUPAC name is 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole |
| PubChem CID | 66739967 |
| Molecular Formula | C9H5IN4S |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole |
| SMILES | Ic1cnc2cc(-c3nncs3)ccn12 |
| InChI | InChI=1S/C9H5IN4S/c10-7-4-11-8-3-6(1-2-14(7)8)9-13-12-5-15-9/h1-5H |
| InChIKey | IDJQDFPAASBHIX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole?
The IUPAC name of 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole (CID 66739967) is 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole is Ic1cnc2cc(-c3nncs3)ccn12.
What is the InChIKey of 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole?
The InChIKey is IDJQDFPAASBHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5IN4S/c10-7-4-11-8-3-6(1-2-14(7)8)9-13-12-5-15-9/h1-5H.
What are the key properties of 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole?
2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole has a molecular weight of 328.14 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-iodoimidazo[1,2-a]pyridin-7-yl)-1,3,4-thiadiazole is sourced from PubChem (CID 66739967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).