C8H12O6 — CID 66740233
[(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate (PubChem CID 66740233) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate.
| Compound Name | [(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate |
|---|---|
| PubChem CID | 66740233 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | [(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate |
| SMILES | COC(=O)O[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C8H12O6/c1-11-8(10)14-5-3-13-6-4(9)2-12-7(5)6/h4-7,9H,2-3H2,1H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | PXMAWNKWGYAGPW-XZBKPIIZSA-N |
| XLogP | -0.70 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |