About 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine
8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 66740315) has the molecular formula C15H15ClN4S
and a molecular weight of 318.83 g/mol. Its IUPAC name is 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine |
| PubChem CID | 66740315 |
| Molecular Formula | C15H15ClN4S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Clc1ccc2sc3c(N4CCCNCC4)ncnc3c2c1 |
| InChI | InChI=1S/C15H15ClN4S/c16-10-2-3-12-11(8-10)13-14(21-12)15(19-9-18-13)20-6-1-4-17-5-7-20/h2-3,8-9,17H,1,4-7H2 |
| InChIKey | ZQLHWWKADHDLJV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine?
The IUPAC name of 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine (CID 66740315) is 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine.
What is the SMILES notation for 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine?
The canonical SMILES for 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine is Clc1ccc2sc3c(N4CCCNCC4)ncnc3c2c1.
What is the InChIKey of 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine?
The InChIKey is ZQLHWWKADHDLJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN4S/c16-10-2-3-12-11(8-10)13-14(21-12)15(19-9-18-13)20-6-1-4-17-5-7-20/h2-3,8-9,17H,1,4-7H2.
What are the key properties of 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine?
8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine has a molecular weight of 318.83 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4-(1,4-diazepan-1-yl)-[1]benzothiolo[3,2-d]pyrimidine is sourced from PubChem (CID 66740315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).