C9H14O6 — CID 66740696
[(3S,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate (PubChem CID 66740696) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is [(3S,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate.
| Compound Name | [(3S,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate |
|---|---|
| PubChem CID | 66740696 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [(3S,3aR,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] methyl carbonate |
| SMILES | COC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC |
| InChI | InChI=1S/C9H14O6/c1-11-5-3-13-8-6(4-14-7(5)8)15-9(10)12-2/h5-8H,3-4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | JHXDUEJPBPHBQI-LXGUWJNJSA-N |
| XLogP | -0.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |