About 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine
6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine (PubChem CID 66741126) has the molecular formula C14H26N6
and a molecular weight of 278.40 g/mol. Its IUPAC name is 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine |
| PubChem CID | 66741126 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine |
| SMILES | CC(C)Cc1c(N)nc(N)nc1N1CCCN(C)CC1 |
| InChI | InChI=1S/C14H26N6/c1-10(2)9-11-12(15)17-14(16)18-13(11)20-6-4-5-19(3)7-8-20/h10H,4-9H2,1-3H3,(H4,15,16,17,18) |
| InChIKey | GBIXGEUXNXQDQL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine (CID 66741126) is 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine is CC(C)Cc1c(N)nc(N)nc1N1CCCN(C)CC1.
What is the InChIKey of 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine?
The InChIKey is GBIXGEUXNXQDQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N6/c1-10(2)9-11-12(15)17-14(16)18-13(11)20-6-4-5-19(3)7-8-20/h10H,4-9H2,1-3H3,(H4,15,16,17,18).
What are the key properties of 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine?
6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine has a molecular weight of 278.40 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-methyl-1,4-diazepan-1-yl)-5-(2-methylpropyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 66741126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).