C25H45BN2O5 — CID 66741580
N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]hexanamide (PubChem CID 66741580) has the molecular formula C25H45BN2O5 and a molecular weight of 464.46 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]hexanamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 66741580 |
| Molecular Formula | C25H45BN2O5 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxobutan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@H](C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1)[C@@H](C)O |
| InChI | InChI=1S/C25H45BN2O5/c1-8-9-10-11-21(30)28-22(16(4)29)23(31)27-20(12-15(2)3)26-32-19-14-17-13-18(24(17,5)6)25(19,7)33-26/h15-20,22,29H,8-14H2,1-7H3,(H,27,31)(H,28,30)/t16-,17+,18+,19-,20+,22+,25+/m1/s1 |
| InChIKey | VYPOVAZVOGNOOA-OKYCDZGRSA-N |
| XLogP | 3.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|