C8H13N3O2 — CID 66741717
1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 66741717) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 66741717 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | O=C1CNC(=O)C2(CCNCC2)N1 |
| InChI | InChI=1S/C8H13N3O2/c12-6-5-10-7(13)8(11-6)1-3-9-4-2-8/h9H,1-5H2,(H,10,13)(H,11,12) |
| InChIKey | RGVFHAWCOKTVTN-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |