C29H41NO3Si — CID 66742013
(1R,4S,6R)-1-tert-butyl-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 66742013) has the molecular formula C29H41NO3Si and a molecular weight of 479.74 g/mol. Its IUPAC name is (1R,4S,6R)-1-tert-butyl-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | (1R,4S,6R)-1-tert-butyl-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 66742013 |
| Molecular Formula | C29H41NO3Si |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (1R,4S,6R)-1-tert-butyl-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-azabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | CC(C)(C)[C@@]12C[C@@H]1C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C(=O)O)C2 |
| InChI | InChI=1S/C29H41NO3Si/c1-27(2,3)29-20-22(29)19-23(30(21-29)26(31)32)17-18-33-34(28(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-16,22-23H,17-21H2,1-6H3,(H,31,32)/t22-,23+,29+/m0/s1 |
| InChIKey | KNXBKQRFXYGWKW-QFWOEDSFSA-N |
| XLogP | 5.76 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|