About 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline
4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline (PubChem CID 66742694) has the molecular formula C32H53NSi2
and a molecular weight of 507.96 g/mol. Its IUPAC name is 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline.
Molecular Properties
| Compound Name | 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline |
| PubChem CID | 66742694 |
| Molecular Formula | C32H53NSi2 |
| Molecular Weight | 507.96 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline |
| SMILES | C=C(c1ccccc1)c1ccc(N([Si](C(C)C)(C(C)C)C(C)C)[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C32H53NSi2/c1-23(2)34(24(3)4,25(5)6)33(35(26(7)8,27(9)10)28(11)12)32-21-19-31(20-22-32)29(13)30-17-15-14-16-18-30/h14-28H,13H2,1-12H3 |
| InChIKey | HGEOFFICWHDJQZ-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.96 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline?
The IUPAC name of 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline (CID 66742694) is 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline.
What is the SMILES notation for 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline?
The canonical SMILES for 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline is C=C(c1ccccc1)c1ccc(N([Si](C(C)C)(C(C)C)C(C)C)[Si](C(C)C)(C(C)C)C(C)C)cc1.
What is the InChIKey of 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline?
The InChIKey is HGEOFFICWHDJQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H53NSi2/c1-23(2)34(24(3)4,25(5)6)33(35(26(7)8,27(9)10)28(11)12)32-21-19-31(20-22-32)29(13)30-17-15-14-16-18-30/h14-28H,13H2,1-12H3.
What are the key properties of 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline?
4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline has a molecular weight of 507.96 g/mol, XLogP of 10.91, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-phenylethenyl)-N,N-bis[tri(propan-2-yl)silyl]aniline is sourced from PubChem (CID 66742694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).