About 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione
3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione (PubChem CID 66742719) has the molecular formula C17H14ClNO2S
and a molecular weight of 331.82 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione.
Molecular Properties
| Compound Name | 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione |
| PubChem CID | 66742719 |
| Molecular Formula | C17H14ClNO2S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C1C2CCC(C2)C(=O)C1c1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H14ClNO2S/c18-12-5-3-9(4-6-12)17-19-13(8-22-17)14-15(20)10-1-2-11(7-10)16(14)21/h3-6,8,10-11,14H,1-2,7H2 |
| InChIKey | AYDLJFVGILMHMF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione?
The IUPAC name of 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione (CID 66742719) is 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione.
What is the SMILES notation for 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione?
The canonical SMILES for 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione is O=C1C2CCC(C2)C(=O)C1c1csc(-c2ccc(Cl)cc2)n1.
What is the InChIKey of 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione?
The InChIKey is AYDLJFVGILMHMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClNO2S/c18-12-5-3-9(4-6-12)17-19-13(8-22-17)14-15(20)10-1-2-11(7-10)16(14)21/h3-6,8,10-11,14H,1-2,7H2.
What are the key properties of 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione?
3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione has a molecular weight of 331.82 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]bicyclo[3.2.1]octane-2,4-dione is sourced from PubChem (CID 66742719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).