C24H29NO5 — CID 66742729
1-[3-(diethylamino)propyl]-2,3,4-trimethoxyanthracene-9,10-dione (PubChem CID 66742729) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-2,3,4-trimethoxyanthracene-9,10-dione.
| Compound Name | 1-[3-(diethylamino)propyl]-2,3,4-trimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 66742729 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-2,3,4-trimethoxyanthracene-9,10-dione |
| SMILES | CCN(CC)CCCc1c(OC)c(OC)c(OC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H29NO5/c1-6-25(7-2)14-10-13-17-18-19(23(29-4)24(30-5)22(17)28-3)21(27)16-12-9-8-11-15(16)20(18)26/h8-9,11-12H,6-7,10,13-14H2,1-5H3 |
| InChIKey | ZPQMCGQDWOLYBX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|