C15H17F3N2O2 — CID 66742759
2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 66742759) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 66742759 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[4-(trifluoromethoxy)phenyl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2ccc(OC(F)(F)F)cc2)CCC12CCNCC2 |
| InChI | InChI=1S/C15H17F3N2O2/c16-15(17,18)22-12-3-1-11(2-4-12)20-10-7-14(13(20)21)5-8-19-9-6-14/h1-4,19H,5-10H2 |
| InChIKey | FRJFQVAADRNWND-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |