C19H24N2O3 — CID 66743533
(1S,2S)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-1-carbonitrile (PubChem CID 66743533) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1S,2S)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | (1S,2S)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 66743533 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (1S,2S)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
| SMILES | COc1ccc2c(c1OC)CC[C@@H](CC1=NC(C)(C)CO1)[C@@H]2C#N |
| InChI | InChI=1S/C19H24N2O3/c1-19(2)11-24-17(21-19)9-12-5-6-14-13(15(12)10-20)7-8-16(22-3)18(14)23-4/h7-8,12,15H,5-6,9,11H2,1-4H3/t12-,15-/m0/s1 |
| InChIKey | OBAISUCJGOLHOT-WFASDCNBSA-N |
| XLogP | 3.47 |
| TPSA | 63.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |