C25H28N2O3 — CID 66743598
(1S,2R)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-3-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbonitrile (PubChem CID 66743598) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (1S,2R)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-3-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | (1S,2R)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-3-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 66743598 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (1S,2R)-2-[(4,4-dimethyl-5H-1,3-oxazol-2-yl)methyl]-5,6-dimethoxy-3-phenyl-1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
| SMILES | COc1ccc2c(c1OC)CC(c1ccccc1)[C@@H](CC1=NC(C)(C)CO1)[C@@H]2C#N |
| InChI | InChI=1S/C25H28N2O3/c1-25(2)15-30-23(27-25)13-19-18(16-8-6-5-7-9-16)12-20-17(21(19)14-26)10-11-22(28-3)24(20)29-4/h5-11,18-19,21H,12-13,15H2,1-4H3/t18?,19-,21-/m1/s1 |
| InChIKey | UBDFNWBJRAEIGI-NYKYFDBJSA-N |
| XLogP | 4.86 |
| TPSA | 63.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |