C28H26ClN9O4 — CID 66744646
7~]Nonadeca-1(18),2,4,6,12,16(19)-hexaen-5-YL)carbamate (PubChem CID 66744646) has the molecular formula C28H26ClN9O4 and a molecular weight of 588.00 g/mol. Its IUPAC name is methyl N-[(12E,15S)-15-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-5-yl]carbamate.
| Compound Name | 7~]Nonadeca-1(18),2,4,6,12,16(19)-hexaen-5-YL)carbamate |
|---|---|
| PubChem CID | 66744646 |
| Molecular Formula | C28H26ClN9O4 |
| Molecular Weight | 588.00 g/mol |
| Exact Mass | 587.18 |
| IUPAC Name | methyl N-[(12E,15S)-15-[[(E)-3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-5-yl]carbamate |
| SMILES | COC(=O)NC1=CC2=C(C=C1)C3=CN=C(N3)[C@H](C/C=C/CCC(=O)N2)NC(=O)/C=C/C4=C(C=CC(=C4)Cl)N5C=NN=N5 |
| InChI | InChI=1S/C28H26ClN9O4/c1-42-28(41)32-19-9-10-20-22(14-19)34-25(39)6-4-2-3-5-21(27-30-15-23(20)35-27)33-26(40)12-7-17-13-18(29)8-11-24(17)38-16-31-36-37-38/h2-3,7-16,21H,4-6H2,1H3,(H,30,35)(H,32,41)(H,33,40)(H,34,39)/b3-2+,12-7+/t21-/m0/s1 |
| InChIKey | LCHKINZSWVDWJQ-XYWZPVONSA-N |
| XLogP | 2.80 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | 1020 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.00 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|