C28H38ClN5O4 — CID 66744731
tert-butyl N-[[4-[(17-chloro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-14-yl)carbamoyl]cyclohexyl]methyl]carbamate (PubChem CID 66744731) has the molecular formula C28H38ClN5O4 and a molecular weight of 544.10 g/mol. Its IUPAC name is tert-butyl N-[[4-[(17-chloro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-14-yl)carbamoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(17-chloro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-14-yl)carbamoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 66744731 |
| Molecular Formula | C28H38ClN5O4 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | tert-butyl N-[[4-[(17-chloro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15(18)-pentaen-14-yl)carbamoyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)NC2CCCCC(=O)Nc3ccccc3-c3nc2[nH]c3Cl)CC1 |
| InChI | InChI=1S/C28H38ClN5O4/c1-28(2,3)38-27(37)30-16-17-12-14-18(15-13-17)26(36)32-21-10-6-7-11-22(35)31-20-9-5-4-8-19(20)23-24(29)34-25(21)33-23/h4-5,8-9,17-18,21H,6-7,10-16H2,1-3H3,(H,30,37)(H,31,35)(H,32,36)(H,33,34) |
| InChIKey | DCRYFJCWDDVNFV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |