About 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol
4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol (PubChem CID 66744767) has the molecular formula C17H26O6
and a molecular weight of 326.39 g/mol. Its IUPAC name is 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol.
Molecular Properties
| Compound Name | 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol |
| PubChem CID | 66744767 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol |
| SMILES | COCOc1ccc(C2(O)CC(C)OC(C)C2)c(OCOC)c1 |
| InChI | InChI=1S/C17H26O6/c1-12-8-17(18,9-13(2)23-12)15-6-5-14(21-10-19-3)7-16(15)22-11-20-4/h5-7,12-13,18H,8-11H2,1-4H3 |
| InChIKey | HVRNJMRHOFJYLZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol?
The IUPAC name of 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol (CID 66744767) is 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol.
What is the SMILES notation for 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol?
The canonical SMILES for 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol is COCOc1ccc(C2(O)CC(C)OC(C)C2)c(OCOC)c1.
What is the InChIKey of 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol?
The InChIKey is HVRNJMRHOFJYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O6/c1-12-8-17(18,9-13(2)23-12)15-6-5-14(21-10-19-3)7-16(15)22-11-20-4/h5-7,12-13,18H,8-11H2,1-4H3.
What are the key properties of 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol?
4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol has a molecular weight of 326.39 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4-bis(methoxymethoxy)phenyl]-2,6-dimethyloxan-4-ol is sourced from PubChem (CID 66744767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).