C28H25ClFN7O2 — CID 66744903
3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-(5-fluoro-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-15-yl)prop-2-enamide (PubChem CID 66744903) has the molecular formula C28H25ClFN7O2 and a molecular weight of 546.01 g/mol. Its IUPAC name is 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-(5-fluoro-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-15-yl)prop-2-enamide.
| Compound Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-(5-fluoro-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-15-yl)prop-2-enamide |
|---|---|
| PubChem CID | 66744903 |
| Molecular Formula | C28H25ClFN7O2 |
| Molecular Weight | 546.01 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 3-[5-chloro-2-(tetrazol-1-yl)phenyl]-N-(5-fluoro-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-15-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1cc(Cl)ccc1-n1cnnn1)NC1CCCCCC(=O)Nc2cc(F)ccc2-c2ccnc1c2 |
| InChI | InChI=1S/C28H25ClFN7O2/c29-20-7-10-26(37-17-32-35-36-37)19(14-20)6-11-28(39)33-23-4-2-1-3-5-27(38)34-24-16-21(30)8-9-22(24)18-12-13-31-25(23)15-18/h6-17,23H,1-5H2,(H,33,39)(H,34,38) |
| InChIKey | OUTJOBDAERRGGC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.01 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|