About 2-chloro-N-methyl-N,3-diphenylpropanamide
2-chloro-N-methyl-N,3-diphenylpropanamide (PubChem CID 66744921) has the molecular formula C16H16ClNO
and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-chloro-N-methyl-N,3-diphenylpropanamide.
Molecular Properties
| Compound Name | 2-chloro-N-methyl-N,3-diphenylpropanamide |
| PubChem CID | 66744921 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-chloro-N-methyl-N,3-diphenylpropanamide |
| SMILES | CN(C(=O)C(Cl)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO/c1-18(14-10-6-3-7-11-14)16(19)15(17)12-13-8-4-2-5-9-13/h2-11,15H,12H2,1H3 |
| InChIKey | ADZQEKYTOIIKCZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methyl-N,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methyl-N,3-diphenylpropanamide?
The IUPAC name of 2-chloro-N-methyl-N,3-diphenylpropanamide (CID 66744921) is 2-chloro-N-methyl-N,3-diphenylpropanamide.
What is the SMILES notation for 2-chloro-N-methyl-N,3-diphenylpropanamide?
The canonical SMILES for 2-chloro-N-methyl-N,3-diphenylpropanamide is CN(C(=O)C(Cl)Cc1ccccc1)c1ccccc1.
What is the InChIKey of 2-chloro-N-methyl-N,3-diphenylpropanamide?
The InChIKey is ADZQEKYTOIIKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO/c1-18(14-10-6-3-7-11-14)16(19)15(17)12-13-8-4-2-5-9-13/h2-11,15H,12H2,1H3.
What are the key properties of 2-chloro-N-methyl-N,3-diphenylpropanamide?
2-chloro-N-methyl-N,3-diphenylpropanamide has a molecular weight of 273.76 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methyl-N,3-diphenylpropanamide is sourced from PubChem (CID 66744921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).