C31H42N6O6 — CID 66745112
tert-butyl 2-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-piperazin-1-ylpyrazin-2-yl]indole-1-carboxylate (PubChem CID 66745112) has the molecular formula C31H42N6O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is tert-butyl 2-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-piperazin-1-ylpyrazin-2-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-piperazin-1-ylpyrazin-2-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 66745112 |
| Molecular Formula | C31H42N6O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | tert-butyl 2-[3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-piperazin-1-ylpyrazin-2-yl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ncc(N2CCNCC2)nc1-c1cc2ccccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H42N6O6/c1-29(2,3)41-26(38)36-21-13-11-10-12-20(21)18-22(36)24-25(33-19-23(34-24)35-16-14-32-15-17-35)37(27(39)42-30(4,5)6)28(40)43-31(7,8)9/h10-13,18-19,32H,14-17H2,1-9H3 |
| InChIKey | ADUMHRRLFQNOHZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|