C37H55N5O4Si2 — CID 66745142
2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]butanoic acid (PubChem CID 66745142) has the molecular formula C37H55N5O4Si2 and a molecular weight of 690.05 g/mol. Its IUPAC name is 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]butanoic acid.
| Compound Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 66745142 |
| Molecular Formula | C37H55N5O4Si2 |
| Molecular Weight | 690.05 g/mol |
| Exact Mass | 689.38 |
| IUPAC Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-quinolin-3-ylpyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]butanoic acid |
| SMILES | CCC(C(=O)O)C1CCC(c2cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc5ccccc5c4)c3n2)CC1 |
| InChI | InChI=1S/C37H55N5O4Si2/c1-8-31(37(43)44)27-13-15-28(16-14-27)34-22-35(41(25-45-17-19-47(2,3)4)26-46-18-20-48(5,6)7)42-36(40-34)32(24-39-42)30-21-29-11-9-10-12-33(29)38-23-30/h9-12,21-24,27-28,31H,8,13-20,25-26H2,1-7H3,(H,43,44) |
| InChIKey | NJYKUUOSEYGAAQ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.05 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|