C22H20N6 — CID 66745574
3-(1H-benzimidazol-2-yl)-5-(1-phenyl-3,6-dihydro-2H-pyridin-4-yl)pyrazin-2-amine (PubChem CID 66745574) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-5-(1-phenyl-3,6-dihydro-2H-pyridin-4-yl)pyrazin-2-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-5-(1-phenyl-3,6-dihydro-2H-pyridin-4-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 66745574 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-5-(1-phenyl-3,6-dihydro-2H-pyridin-4-yl)pyrazin-2-amine |
| SMILES | Nc1ncc(C2=CCN(c3ccccc3)CC2)nc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H20N6/c23-21-20(22-26-17-8-4-5-9-18(17)27-22)25-19(14-24-21)15-10-12-28(13-11-15)16-6-2-1-3-7-16/h1-10,14H,11-13H2,(H2,23,24)(H,26,27) |
| InChIKey | CWQYPWOEWUAQAQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|