C37H57BrN6O3Si2 — CID 66746117
6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis[2-(2-trimethylsilylethoxy)butan-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 66746117) has the molecular formula C37H57BrN6O3Si2 and a molecular weight of 769.98 g/mol. Its IUPAC name is 6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis[2-(2-trimethylsilylethoxy)butan-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis[2-(2-trimethylsilylethoxy)butan-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 66746117 |
| Molecular Formula | C37H57BrN6O3Si2 |
| Molecular Weight | 769.98 g/mol |
| Exact Mass | 768.32 |
| IUPAC Name | 6-bromo-5-morpholin-4-yl-3-quinolin-3-yl-N,N-bis[2-(2-trimethylsilylethoxy)butan-2-yl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCC(C)(OCC[Si](C)(C)C)N(c1c(Br)c(N2CCOCC2)nc2c(-c3cnc4ccccc4c3)cnn12)C(C)(CC)OCC[Si](C)(C)C |
| InChI | InChI=1S/C37H57BrN6O3Si2/c1-11-36(3,46-21-23-48(5,6)7)44(37(4,12-2)47-22-24-49(8,9)10)35-32(38)34(42-17-19-45-20-18-42)41-33-30(27-40-43(33)35)29-25-28-15-13-14-16-31(28)39-26-29/h13-16,25-27H,11-12,17-24H2,1-10H3 |
| InChIKey | TVNNASVUXOZNCS-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 77.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.98 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|