About aniline;N-phenylaniline;phosphoric acid
aniline;N-phenylaniline;phosphoric acid (PubChem CID 66746384) has the molecular formula C18H21N2O4P
and a molecular weight of 360.35 g/mol. Its IUPAC name is aniline;N-phenylaniline;phosphoric acid.
Molecular Properties
| Compound Name | aniline;N-phenylaniline;phosphoric acid |
| PubChem CID | 66746384 |
| Molecular Formula | C18H21N2O4P |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | aniline;N-phenylaniline;phosphoric acid |
| SMILES | Nc1ccccc1.O=P(O)(O)O.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C6H7N.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-10,13H;1-5H,7H2;(H3,1,2,3,4) |
| InChIKey | JHGNIEZCJUOFBE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aniline;N-phenylaniline;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;N-phenylaniline;phosphoric acid?
The IUPAC name of aniline;N-phenylaniline;phosphoric acid (CID 66746384) is aniline;N-phenylaniline;phosphoric acid.
What is the SMILES notation for aniline;N-phenylaniline;phosphoric acid?
The canonical SMILES for aniline;N-phenylaniline;phosphoric acid is Nc1ccccc1.O=P(O)(O)O.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of aniline;N-phenylaniline;phosphoric acid?
The InChIKey is JHGNIEZCJUOFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C6H7N.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-6-4-2-1-3-5-6;1-5(2,3)4/h1-10,13H;1-5H,7H2;(H3,1,2,3,4).
What are the key properties of aniline;N-phenylaniline;phosphoric acid?
aniline;N-phenylaniline;phosphoric acid has a molecular weight of 360.35 g/mol, XLogP of 3.77, 2 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;N-phenylaniline;phosphoric acid is sourced from PubChem (CID 66746384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).