About 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol
1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol (PubChem CID 66747180) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol |
| PubChem CID | 66747180 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol |
| SMILES | CC(C)CC1=CCC(C)(C(C)O)C(C)C1 |
| InChI | InChI=1S/C14H26O/c1-10(2)8-13-6-7-14(5,12(4)15)11(3)9-13/h6,10-12,15H,7-9H2,1-5H3 |
| InChIKey | IHIJQSVNHRHHQN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol?
The IUPAC name of 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol (CID 66747180) is 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol.
What is the SMILES notation for 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol?
The canonical SMILES for 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol is CC(C)CC1=CCC(C)(C(C)O)C(C)C1.
What is the InChIKey of 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol?
The InChIKey is IHIJQSVNHRHHQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-10(2)8-13-6-7-14(5,12(4)15)11(3)9-13/h6,10-12,15H,7-9H2,1-5H3.
What are the key properties of 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol?
1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol has a molecular weight of 210.36 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,6-dimethyl-4-(2-methylpropyl)cyclohex-3-en-1-yl]ethanol is sourced from PubChem (CID 66747180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).