C17H13F3N2O2 — CID 66747768
3-[7-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxypyridin-2-amine (PubChem CID 66747768) has the molecular formula C17H13F3N2O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 3-[7-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxypyridin-2-amine.
| Compound Name | 3-[7-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxypyridin-2-amine |
|---|---|
| PubChem CID | 66747768 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-[7-(2,2,2-trifluoroethoxy)naphthalen-2-yl]oxypyridin-2-amine |
| SMILES | Nc1ncccc1Oc1ccc2ccc(OCC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C17H13F3N2O2/c18-17(19,20)10-23-13-5-3-11-4-6-14(9-12(11)8-13)24-15-2-1-7-22-16(15)21/h1-9H,10H2,(H2,21,22) |
| InChIKey | KQGPJKXNWTZKEG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |