About 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline
6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline (PubChem CID 66747882) has the molecular formula C13H8Br2ClNS
and a molecular weight of 405.54 g/mol. Its IUPAC name is 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline |
| PubChem CID | 66747882 |
| Molecular Formula | C13H8Br2ClNS |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 402.84 |
| IUPAC Name | 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline |
| SMILES | Clc1ccc2c(c1)CCN=C2c1cc(Br)sc1Br |
| InChI | InChI=1S/C13H8Br2ClNS/c14-11-6-10(13(15)18-11)12-9-2-1-8(16)5-7(9)3-4-17-12/h1-2,5-6H,3-4H2 |
| InChIKey | HHCXWEVZFGOUSI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline?
The IUPAC name of 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline (CID 66747882) is 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline?
The canonical SMILES for 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline is Clc1ccc2c(c1)CCN=C2c1cc(Br)sc1Br.
What is the InChIKey of 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline?
The InChIKey is HHCXWEVZFGOUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Br2ClNS/c14-11-6-10(13(15)18-11)12-9-2-1-8(16)5-7(9)3-4-17-12/h1-2,5-6H,3-4H2.
What are the key properties of 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline?
6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline has a molecular weight of 405.54 g/mol, XLogP of 5.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-(2,5-dibromothiophen-3-yl)-3,4-dihydroisoquinoline is sourced from PubChem (CID 66747882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).