C11H16IN5O2S2 — CID 66748226
5-iodo-N-methyl-N-(1-methylsulfonylpiperidin-4-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 66748226) has the molecular formula C11H16IN5O2S2 and a molecular weight of 441.32 g/mol. Its IUPAC name is 5-iodo-N-methyl-N-(1-methylsulfonylpiperidin-4-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 5-iodo-N-methyl-N-(1-methylsulfonylpiperidin-4-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 66748226 |
| Molecular Formula | C11H16IN5O2S2 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 5-iodo-N-methyl-N-(1-methylsulfonylpiperidin-4-yl)imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | CN(c1nn2c(I)cnc2s1)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H16IN5O2S2/c1-15(8-3-5-16(6-4-8)21(2,18)19)11-14-17-9(12)7-13-10(17)20-11/h7-8H,3-6H2,1-2H3 |
| InChIKey | WYFJIJQKIBZVFN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|