About 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride
3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride (PubChem CID 66748271) has the molecular formula C10H18ClN3O
and a molecular weight of 231.73 g/mol. Its IUPAC name is 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride.
Molecular Properties
| Compound Name | 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride |
| PubChem CID | 66748271 |
| Molecular Formula | C10H18ClN3O |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride |
| SMILES | C=C[N+]1=C(C)NCC1.O=C1CCCN1.[Cl-] |
| InChI | InChI=1S/C6H10N2.C4H7NO.ClH/c1-3-8-5-4-7-6(8)2;6-4-2-1-3-5-4;/h3H,1,4-5H2,2H3;1-3H2,(H,5,6);1H |
| InChIKey | QKSXBNFQOGTQQF-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 44.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride?
The IUPAC name of 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride (CID 66748271) is 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride.
What is the SMILES notation for 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride?
The canonical SMILES for 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride is C=C[N+]1=C(C)NCC1.O=C1CCCN1.[Cl-].
What is the InChIKey of 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride?
The InChIKey is QKSXBNFQOGTQQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C4H7NO.ClH/c1-3-8-5-4-7-6(8)2;6-4-2-1-3-5-4;/h3H,1,4-5H2,2H3;1-3H2,(H,5,6);1H.
What are the key properties of 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride?
3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride has a molecular weight of 231.73 g/mol, XLogP of -2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2-methyl-4,5-dihydro-1H-imidazol-3-ium;pyrrolidin-2-one;chloride is sourced from PubChem (CID 66748271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).