About 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride
4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride (PubChem CID 66748286) has the molecular formula C10H15Cl2F3N4O
and a molecular weight of 335.16 g/mol. Its IUPAC name is 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride |
| PubChem CID | 66748286 |
| Molecular Formula | C10H15Cl2F3N4O |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)COc1cc(N2CCNCC2)ncn1 |
| InChI | InChI=1S/C10H13F3N4O.2ClH/c11-10(12,13)6-18-9-5-8(15-7-16-9)17-3-1-14-2-4-17;;/h5,7,14H,1-4,6H2;2*1H |
| InChIKey | KREPAAHJFABILN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride?
The IUPAC name of 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride (CID 66748286) is 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride.
What is the SMILES notation for 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride?
The canonical SMILES for 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride is Cl.Cl.FC(F)(F)COc1cc(N2CCNCC2)ncn1.
What is the InChIKey of 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride?
The InChIKey is KREPAAHJFABILN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N4O.2ClH/c11-10(12,13)6-18-9-5-8(15-7-16-9)17-3-1-14-2-4-17;;/h5,7,14H,1-4,6H2;2*1H.
What are the key properties of 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride?
4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride has a molecular weight of 335.16 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-6-(2,2,2-trifluoroethoxy)pyrimidine;dihydrochloride is sourced from PubChem (CID 66748286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).