C19H19NO3S — CID 66748856
5-benzyl-3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one (PubChem CID 66748856) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 5-benzyl-3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one.
| Compound Name | 5-benzyl-3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one |
|---|---|
| PubChem CID | 66748856 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-benzyl-3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one |
| SMILES | COc1ccc(C2=NC(Cc3ccccc3)C(=O)SC2)c(OC)c1 |
| InChI | InChI=1S/C19H19NO3S/c1-22-14-8-9-15(18(11-14)23-2)17-12-24-19(21)16(20-17)10-13-6-4-3-5-7-13/h3-9,11,16H,10,12H2,1-2H3 |
| InChIKey | AURFIZGEZDKBOC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|