C21H18N2O2S — CID 66748913
9-[4-(2-phenylethenyl)phenyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide (PubChem CID 66748913) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 9-[4-(2-phenylethenyl)phenyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide.
| Compound Name | 9-[4-(2-phenylethenyl)phenyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
|---|---|
| PubChem CID | 66748913 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 9-[4-(2-phenylethenyl)phenyl]-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
| SMILES | O=S1(=O)CCN2C=CC=C(c3ccc(C=Cc4ccccc4)cc3)C2=N1 |
| InChI | InChI=1S/C21H18N2O2S/c24-26(25)16-15-23-14-4-7-20(21(23)22-26)19-12-10-18(11-13-19)9-8-17-5-2-1-3-6-17/h1-14H,15-16H2 |
| InChIKey | FPKQCZVRDLYOLQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|