C15H19NO3S — CID 66749130
3-(2,4-dimethoxyphenyl)-5-propan-2-yl-2,5-dihydro-1,4-thiazin-6-one (PubChem CID 66749130) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-5-propan-2-yl-2,5-dihydro-1,4-thiazin-6-one.
| Compound Name | 3-(2,4-dimethoxyphenyl)-5-propan-2-yl-2,5-dihydro-1,4-thiazin-6-one |
|---|---|
| PubChem CID | 66749130 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-5-propan-2-yl-2,5-dihydro-1,4-thiazin-6-one |
| SMILES | COc1ccc(C2=NC(C(C)C)C(=O)SC2)c(OC)c1 |
| InChI | InChI=1S/C15H19NO3S/c1-9(2)14-15(17)20-8-12(16-14)11-6-5-10(18-3)7-13(11)19-4/h5-7,9,14H,8H2,1-4H3 |
| InChIKey | OAILECFPFMLMNN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|