About 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine
6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine (PubChem CID 66749583) has the molecular formula C12H16BrNO
and a molecular weight of 270.17 g/mol. Its IUPAC name is 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine.
Molecular Properties
| Compound Name | 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine |
| PubChem CID | 66749583 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine |
| SMILES | CCCCCC1Cc2ncc(Br)cc2O1 |
| InChI | InChI=1S/C12H16BrNO/c1-2-3-4-5-10-7-11-12(15-10)6-9(13)8-14-11/h6,8,10H,2-5,7H2,1H3 |
| InChIKey | WRVSTUCBTXVYJI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine?
The IUPAC name of 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine (CID 66749583) is 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine.
What is the SMILES notation for 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine?
The canonical SMILES for 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine is CCCCCC1Cc2ncc(Br)cc2O1.
What is the InChIKey of 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine?
The InChIKey is WRVSTUCBTXVYJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO/c1-2-3-4-5-10-7-11-12(15-10)6-9(13)8-14-11/h6,8,10H,2-5,7H2,1H3.
What are the key properties of 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine?
6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine has a molecular weight of 270.17 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-pentyl-2,3-dihydrofuro[3,2-b]pyridine is sourced from PubChem (CID 66749583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).