About 2-pentyl-1,3-thiazol-4-amine
2-pentyl-1,3-thiazol-4-amine (PubChem CID 66749642) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-pentyl-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-pentyl-1,3-thiazol-4-amine |
| PubChem CID | 66749642 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-pentyl-1,3-thiazol-4-amine |
| SMILES | CCCCCc1nc(N)cs1 |
| InChI | InChI=1S/C8H14N2S/c1-2-3-4-5-8-10-7(9)6-11-8/h6H,2-5,9H2,1H3 |
| InChIKey | UQFDCTHQABNNLT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-1,3-thiazol-4-amine?
The IUPAC name of 2-pentyl-1,3-thiazol-4-amine (CID 66749642) is 2-pentyl-1,3-thiazol-4-amine.
What is the SMILES notation for 2-pentyl-1,3-thiazol-4-amine?
The canonical SMILES for 2-pentyl-1,3-thiazol-4-amine is CCCCCc1nc(N)cs1.
What is the InChIKey of 2-pentyl-1,3-thiazol-4-amine?
The InChIKey is UQFDCTHQABNNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-2-3-4-5-8-10-7(9)6-11-8/h6H,2-5,9H2,1H3.
What are the key properties of 2-pentyl-1,3-thiazol-4-amine?
2-pentyl-1,3-thiazol-4-amine has a molecular weight of 170.28 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-1,3-thiazol-4-amine is sourced from PubChem (CID 66749642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).