About 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one
3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one (PubChem CID 66749677) has the molecular formula C12H13NO3S
and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one.
Molecular Properties
| Compound Name | 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one |
| PubChem CID | 66749677 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one |
| SMILES | COc1ccc(C2=NCC(=O)SC2)c(OC)c1 |
| InChI | InChI=1S/C12H13NO3S/c1-15-8-3-4-9(11(5-8)16-2)10-7-17-12(14)6-13-10/h3-5H,6-7H2,1-2H3 |
| InChIKey | NKTMMQFAFUHUMC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one (CID 66749677) is 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one is COc1ccc(C2=NCC(=O)SC2)c(OC)c1.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one?
The InChIKey is NKTMMQFAFUHUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3S/c1-15-8-3-4-9(11(5-8)16-2)10-7-17-12(14)6-13-10/h3-5H,6-7H2,1-2H3.
What are the key properties of 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one?
3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one has a molecular weight of 251.31 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-2,5-dihydro-1,4-thiazin-6-one is sourced from PubChem (CID 66749677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).