About 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid
2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid (PubChem CID 66749918) has the molecular formula C24H41O5P
and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid.
Molecular Properties
| Compound Name | 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid |
| PubChem CID | 66749918 |
| Molecular Formula | C24H41O5P |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid |
| SMILES | CCCCCCCCCC1(C)CCc2cc(OC(CCC)CP(=O)(O)O)ccc2O1 |
| InChI | InChI=1S/C24H41O5P/c1-4-6-7-8-9-10-11-16-24(3)17-15-20-18-21(13-14-23(20)29-24)28-22(12-5-2)19-30(25,26)27/h13-14,18,22H,4-12,15-17,19H2,1-3H3,(H2,25,26,27) |
| InChIKey | RDNRUNGOBIBUMF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid?
The IUPAC name of 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid (CID 66749918) is 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid.
What is the SMILES notation for 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid?
The canonical SMILES for 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid is CCCCCCCCCC1(C)CCc2cc(OC(CCC)CP(=O)(O)O)ccc2O1.
What is the InChIKey of 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid?
The InChIKey is RDNRUNGOBIBUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H41O5P/c1-4-6-7-8-9-10-11-16-24(3)17-15-20-18-21(13-14-23(20)29-24)28-22(12-5-2)19-30(25,26)27/h13-14,18,22H,4-12,15-17,19H2,1-3H3,(H2,25,26,27).
What are the key properties of 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid?
2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid has a molecular weight of 440.56 g/mol, XLogP of 6.64, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-2-nonyl-3,4-dihydrochromen-6-yl)oxy]pentylphosphonic acid is sourced from PubChem (CID 66749918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).