About 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine
2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine (PubChem CID 66749953) has the molecular formula C6H7N3S
and a molecular weight of 153.21 g/mol. Its IUPAC name is 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine.
Molecular Properties
| Compound Name | 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine |
| PubChem CID | 66749953 |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine |
| SMILES | NC1=CC=CN2SNC=C12 |
| InChI | InChI=1S/C6H7N3S/c7-5-2-1-3-9-6(5)4-8-10-9/h1-4,8H,7H2 |
| InChIKey | QVPNXHGKVUPALO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine?
The IUPAC name of 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine (CID 66749953) is 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine.
What is the SMILES notation for 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine?
The canonical SMILES for 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine is NC1=CC=CN2SNC=C12.
What is the InChIKey of 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine?
The InChIKey is QVPNXHGKVUPALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3S/c7-5-2-1-3-9-6(5)4-8-10-9/h1-4,8H,7H2.
What are the key properties of 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine?
2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine has a molecular weight of 153.21 g/mol, XLogP of 0.67, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-[1,2,5]thiadiazolo[2,3-a]pyridin-4-amine is sourced from PubChem (CID 66749953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).