C19H19NO4S — CID 66750003
(5S)-3-(2,4-dimethoxyphenyl)-5-[(4-hydroxyphenyl)methyl]-2,5-dihydro-1,4-thiazin-6-one (PubChem CID 66750003) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is (5S)-3-(2,4-dimethoxyphenyl)-5-[(4-hydroxyphenyl)methyl]-2,5-dihydro-1,4-thiazin-6-one.
| Compound Name | (5S)-3-(2,4-dimethoxyphenyl)-5-[(4-hydroxyphenyl)methyl]-2,5-dihydro-1,4-thiazin-6-one |
|---|---|
| PubChem CID | 66750003 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (5S)-3-(2,4-dimethoxyphenyl)-5-[(4-hydroxyphenyl)methyl]-2,5-dihydro-1,4-thiazin-6-one |
| SMILES | COc1ccc(C2=N[C@@H](Cc3ccc(O)cc3)C(=O)SC2)c(OC)c1 |
| InChI | InChI=1S/C19H19NO4S/c1-23-14-7-8-15(18(10-14)24-2)17-11-25-19(22)16(20-17)9-12-3-5-13(21)6-4-12/h3-8,10,16,21H,9,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | WROWNVRJOOYZFO-INIZCTEOSA-N |
| XLogP | 3.08 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|